CAS 80887-27-0
:N-[(2R,4aR,6R,7R,8R,8aS)-6-azido-8-benzyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide
Description:
N-[(2R,4aR,6R,7R,8R,8aS)-6-azido-8-benzyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide, with CAS number 80887-27-0, is a complex organic compound characterized by its unique structural features, including a hexahydropyrano dioxin core and an azido functional group. This compound exhibits chirality, indicated by its multiple stereocenters, which can influence its biological activity and interactions. The presence of the benzyloxy group suggests potential for hydrophobic interactions, while the azido group may serve as a reactive site for further chemical modifications or conjugations. Its acetamide moiety contributes to its solubility and stability in various solvents. Such compounds are often of interest in medicinal chemistry and drug development due to their potential pharmacological properties. The intricate structure may also imply specific reactivity patterns, making it a candidate for further research in synthetic applications or biological studies. Overall, this compound exemplifies the complexity and diversity found in organic chemistry, particularly in the design of bioactive molecules.
Formula:C22H24N4O5
InChI:InChI=1/C22H24N4O5/c1-14(27)24-18-20(28-12-15-8-4-2-5-9-15)19-17(30-21(18)25-26-23)13-29-22(31-19)16-10-6-3-7-11-16/h2-11,17-22H,12-13H2,1H3,(H,24,27)/t17-,18-,19-,20-,21-,22-/m1/s1
SMILES:CC(=N[C@@H]1[C@H]([C@H]2[C@@H](CO[C@@H](c3ccccc3)O2)O[C@H]1N=[N+]=[NH-])OCc1ccccc1)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Acetamido-3-O-benzyl-4,6-O-benzylidene-2-deoxy-β-D-glucopyranosyl Azide
CAS:Formula:C22H24N4O5Purity:97%Color and Shape:SolidMolecular weight:424.44982-Acetamido-3-O-benzyl-4,6-O-benzylidene-2-deoxy-b-D-glucopyranosyl azide
CAS:<p>2-Acetamido-3-O-benzyl-4,6-O-benzylidene-2-deoxy-b-D-glucopyranosyl azide is a modified carbohydrate that is used in the synthesis of glycosides. It is a synthetic molecule that is fluorinated at the alpha position of the glycosidic bond to allow for reaction with other molecules. This product has been shown to be stable in acid and base reactions and can be used for oligosaccharide synthesis or modification.</p>Formula:C22H24N4O5Purity:Min. 95%Color and Shape:PowderMolecular weight:424.46 g/mol2-Acetamido-3-O-benzyl-4,6-O-benzylidene-2-deoxy-β-D-glucopyranosyl Azide
CAS:Controlled ProductFormula:C22H24N4O5Color and Shape:NeatMolecular weight:424.45




