CymitQuimica logo

CAS 80888-36-4

:

2,6-Dimethoxy-α,4-dimethylbenzeneethanamine

Description:
2,6-Dimethoxy-α,4-dimethylbenzeneethanamine, also known by its CAS number 80888-36-4, is a chemical compound that belongs to the class of substituted phenethylamines. This substance features a benzene ring with two methoxy groups and additional methyl groups, contributing to its unique structural characteristics. The presence of the amine functional group indicates that it may exhibit basic properties and can participate in various chemical reactions, such as alkylation or acylation. The methoxy groups can influence the compound's solubility and reactivity, often enhancing its lipophilicity. Additionally, the steric hindrance introduced by the methyl groups can affect the compound's biological activity and interaction with receptors. While specific biological or pharmacological properties may vary, compounds of this class are often studied for their potential effects on neurotransmitter systems. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Further research is necessary to fully understand its applications and effects in various fields, including medicinal chemistry and materials science.
Formula:C12H19NO2
InChI:InChI=1S/C12H19NO2/c1-8-5-11(14-3)10(7-9(2)13)12(6-8)15-4/h5-6,9H,7,13H2,1-4H3
InChI key:InChIKey=CFFJUEYUTHKVMQ-UHFFFAOYSA-N
SMILES:C(C(C)N)C1=C(OC)C=C(C)C=C1OC
Synonyms:
  • Benzeneethanamine, 2,6-dimethoxy-α,4-dimethyl-, (±)-
  • 2,6-Dimethoxy-4-methylamphetamine
  • Benzeneethanamine, 2,6-dimethoxy-α,4-dimethyl-
  • 2,6-Dimethoxy-α,4-dimethylbenzeneethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.