
CAS 80900-27-2
:1,4,7,10-Tetraoxa-13-azacyclopentadecane-13-carbonitrile
Description:
1,4,7,10-Tetraoxa-13-azacyclopentadecane-13-carbonitrile, with CAS number 80900-27-2, is a complex organic compound characterized by its unique cyclic structure that incorporates both nitrogen and oxygen atoms. This compound features a 15-membered ring, which includes four ether (–O–) linkages and one nitrogen atom, contributing to its stability and potential for forming coordination complexes. The presence of a carbonitrile (–C≡N) functional group enhances its reactivity and solubility in polar solvents. The molecular architecture allows for various applications, particularly in coordination chemistry, where it may act as a ligand for metal ions. Its structural features may also impart interesting properties such as chelation, which can be useful in biological systems or materials science. Additionally, the compound's stability and functional groups suggest potential utility in drug design or as a building block in organic synthesis. Overall, 1,4,7,10-Tetraoxa-13-azacyclopentadecane-13-carbonitrile is a versatile compound with significant implications in various fields of chemistry.
Formula:C11H20N2O4
InChI:InChI=1S/C11H20N2O4/c12-11-13-1-3-14-5-7-16-9-10-17-8-6-15-4-2-13/h1-10H2
InChI key:InChIKey=ZXFBJJNPLKHAKE-UHFFFAOYSA-N
SMILES:C(#N)N1CCOCCOCCOCCOCC1
Synonyms:- 1,4,7,10-Tetraoxa-13-azacyclopentadecane-13-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,4,7,10-Tetraoxa-13-azacyclopentadecane-13-carbonitrile
CAS:Formula:C11H20N2O4Molecular weight:244.2875
