
CAS 80900-28-3
:1,4,7,10,13-Pentaoxa-16-azacyclooctadecane-16-carbonitrile
Description:
1,4,7,10,13-Pentaoxa-16-azacyclooctadecane-16-carbonitrile, also known by its CAS number 80900-28-3, is a complex organic compound characterized by its unique structure that includes multiple ether and amine functional groups. This compound features a cyclic arrangement with five ether linkages and one nitrogen atom integrated into the ring, contributing to its potential solubility in polar solvents. The presence of a carbonitrile group at the terminal position enhances its reactivity, making it useful in various chemical applications, including coordination chemistry and as a ligand in metal complexes. The compound's structural attributes suggest it may exhibit interesting properties such as chelation ability, which can be exploited in catalysis or material science. Additionally, due to its multi-functional nature, it may have potential applications in pharmaceuticals or as a building block in organic synthesis. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C13H24N2O5
InChI:InChI=1S/C13H24N2O5/c14-13-15-1-3-16-5-7-18-9-11-20-12-10-19-8-6-17-4-2-15/h1-12H2
InChI key:InChIKey=ANZGDQIYVOSPQQ-UHFFFAOYSA-N
SMILES:C(#N)N1CCOCCOCCOCCOCCOCC1
Synonyms:- 1,4,7,10,13-Pentaoxa-16-azacyclooctadecane-16-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,4,7,10,13-Pentaoxa-16-azacyclooctadecane-16-carbonitrile
CAS:Formula:C13H24N2O5Molecular weight:288.3401
