CAS 80902-01-8
:haloquinone
Description:
Haloquinone refers to a class of chemical compounds that are derived from quinones, which are cyclic organic compounds containing two carbonyl groups. The specific compound with the CAS number 80902-01-8 is a halogenated derivative of quinone, characterized by the presence of halogen atoms (such as chlorine, bromine, or iodine) attached to the quinone structure. These compounds typically exhibit unique chemical reactivity due to the electron-withdrawing nature of the halogen substituents, which can influence their behavior in various chemical reactions, including electrophilic substitution and redox processes. Haloquinones are often used in organic synthesis and can serve as intermediates in the production of dyes, pharmaceuticals, and agrochemicals. Additionally, they may possess biological activity, making them of interest in medicinal chemistry. The stability, solubility, and reactivity of haloquinones can vary significantly depending on the specific halogen and the position of substitution on the quinone ring.
Formula:C17H12O5
InChI:InChI=1/C17H12O5/c1-7-10(8(2)18)6-11-9-4-3-5-12(19)13(9)16(21)17(22)14(11)15(7)20/h3-6,19-20H,1-2H3
Synonyms:- haloquinone
- 9,10-Phenanthrenedione, 3-acetyl-1,8-dihydroxy-2-methyl-
- 3-Acetyl-1,8-dihydroxy-2-methyl-9,10-phenanthrenedione
- 3-Acetyl-1,8-dihydroxy-2-methyl-9,10-phenanthrenequinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Haloquinone
CAS:<p>Haloquinone is a quinone antibiotic that exhibits significant antibacterial activity against halophilic bacteria and is also effective against Gram-positive bacteria and mycoplasma.</p>Formula:C17H12O5Color and Shape:SolidMolecular weight:296.274
