CymitQuimica logo

CAS 80904-75-2

:

4-(hydroxymethyl)furan-2(5H)-one

Description:
4-(Hydroxymethyl)furan-2(5H)-one, also known as a derivative of furan, is an organic compound characterized by its furan ring structure with a hydroxymethyl group attached. This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar solvents due to the presence of the hydroxymethyl group, which enhances its hydrophilicity. It is known for its potential applications in various fields, including pharmaceuticals and food chemistry, owing to its bioactive properties. The compound may exhibit antioxidant and antimicrobial activities, making it of interest in the development of natural preservatives and health-related products. Additionally, its reactivity can be influenced by the furan ring, which can participate in various chemical reactions, including electrophilic substitutions and polymerization processes. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 4-(hydroxymethyl)furan-2(5H)-one represents a versatile compound with significant potential in both industrial and research applications.
Formula:C5H6O3
InChI:InChI=1/C5H6O3/c6-2-4-1-5(7)8-3-4/h1,6H,2-3H2
SMILES:C1=C(CO)COC1=O
Synonyms:
  • 2(5H)-Furanone, 4-(hydroxymethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.