CAS 80904-86-5

3-(1-methylethyl)tricyclo[3.3.1.1~3,7~]decan-1-amine

Description:

3-(1-Methylethyl)tricyclo[3.3.1.1^3,7]decan-1-amine, with the CAS number 80904-86-5, is a bicyclic amine compound characterized by its complex tricyclic structure. This compound features a tricyclodecane framework, which contributes to its unique three-dimensional shape and steric properties. The presence of the isopropyl group (1-methylethyl) at the 3-position introduces additional steric hindrance, influencing its reactivity and interaction with biological systems. As an amine, it possesses a nitrogen atom that can participate in hydrogen bonding, making it potentially useful in various chemical reactions and applications, including pharmaceuticals and organic synthesis. The compound's physical properties, such as boiling point, melting point, and solubility, would depend on its molecular interactions and the presence of functional groups. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly in the context of cyclic amines and their derivatives.

Formula: C₁₃H₂₃N

InChI: InChI=1/C13H23N/c1-9(2)12-4-10-3-11(5-12)7-13(14,6-10)8-12/h9-11H,3-8,14H2,1-2H3

SMILES: CC(C)C12CC3CC(C1)CC(C3)(C2)N

Synonyms:

• 3-(Propan-2-Yl)Tricyclo[3.3.1.1~3,7~]Decan-1-Amine
• Tricyclo[3.3.1.1~3,7~]Decan-1-Amine, 3-(1-Methylethyl)-