CAS 80912-09-0
:1,2-dimethyl-1H-imidazol-5-amine
Description:
1,2-Dimethyl-1H-imidazol-5-amine is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features two methyl groups attached to the first carbon of the imidazole ring and an amino group at the fifth position. It is typically a colorless to light yellow liquid or solid, depending on its purity and form. The presence of the amino group makes it a basic compound, capable of participating in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Its solubility in polar solvents, such as water and alcohols, is notable, which enhances its utility in various chemical applications, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C5H9N3
InChI:InChI=1/C5H9N3/c1-4-7-3-5(6)8(4)2/h3H,6H2,1-2H3
SMILES:Cc1ncc(N)n1C
Synonyms:- 1H-imidazol-5-amine, 1,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.