CAS 80913-66-2
:4-methylmorpholine-4-oxide monohydrate
Description:
4-Methylmorpholine-4-oxide monohydrate is an organic compound characterized by its morpholine structure, which includes a nitrogen atom in a six-membered ring. This compound is typically a colorless to pale yellow solid that is hygroscopic, meaning it readily absorbs moisture from the environment. It is known for its role as an oxidizing agent and is often used in various chemical reactions, particularly in organic synthesis and as a reagent in the preparation of other chemical compounds. The presence of the methyl group enhances its solubility in polar solvents, making it versatile in different chemical environments. Additionally, the monohydrate form indicates that it contains one molecule of water per molecule of the compound, which can influence its physical properties and stability. Safety considerations should be taken into account when handling this substance, as it may pose health risks if inhaled or ingested. Overall, 4-methylmorpholine-4-oxide monohydrate is valued in the chemical industry for its reactivity and utility in synthetic applications.
Formula:C5H13NO3
InChI:InChI=1/C5H11NO2.H2O/c1-6(7)2-4-8-5-3-6;/h2-5H2,1H3;1H2
Synonyms:- 4-Methylmorpholine N-oxide hydrate
- N-MethylmorpholineN-oxide monohydrate
- 4-methylmorpholine 4-oxide hydrate
- 4-MethylmorpholineN-oxide,ca50%aq.soln.
- 4-methylmorpholine 4-oxide
- 4-Methylmorpholine N-oxide monohydrate
- N-methyl morpholine-N-Oxid monohydrate
- monohydrate~NMMO
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4-Methylmorpholine N-oxide hydrate
CAS:Formula:C5H13NO3Purity:95%Color and Shape:SolidMolecular weight:135.1616

