CAS 80914-30-3
:ethyl 3-amino-4-methylpentanoate
Description:
Ethyl 3-amino-4-methylpentanoate, with the CAS number 80914-30-3, is an organic compound characterized by its ester functional group, which is derived from the reaction of an amino acid and an alcohol. This compound features a pentanoate backbone, indicating a five-carbon chain, with an amino group (-NH2) and a methyl group (-CH3) substituent that contribute to its unique properties. Ethyl 3-amino-4-methylpentanoate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents and may exhibit moderate solubility in water due to the presence of the amino group. The compound is of interest in various fields, including pharmaceuticals and biochemistry, due to its potential applications in drug synthesis and as a building block for more complex molecules. Its reactivity is influenced by the amino and ester functional groups, allowing for various chemical transformations. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H17NO2
InChI:InChI=1/C8H17NO2/c1-4-11-8(10)5-7(9)6(2)3/h6-7H,4-5,9H2,1-3H3
SMILES:CCOC(=O)CC(C(C)C)N
Synonyms:- 3-Amino-4-methyl-pentanoic acid ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.