CAS 80914-37-0
:3-aminopentanoic acid hydrochloride
Description:
3-Aminopentanoic acid hydrochloride, also known as 3-aminopentanoic acid or β-aminovaleric acid hydrochloride, is an organic compound characterized by its amino acid structure, which includes both an amine and a carboxylic acid functional group. It is a white to off-white crystalline solid that is soluble in water, making it suitable for various applications in biochemistry and pharmaceuticals. The presence of the hydrochloride salt form enhances its stability and solubility in aqueous solutions. This compound is often used in the synthesis of peptides and as a building block in organic synthesis. Its molecular structure includes a five-carbon chain with an amino group located at the third carbon, contributing to its classification as a β-amino acid. Additionally, it exhibits properties typical of amino acids, such as the ability to participate in hydrogen bonding and form zwitterions in solution. As with many amino acids, it may also play a role in metabolic processes and can be involved in the synthesis of neurotransmitters or other biologically relevant molecules.
Formula:C5H12ClNO2
InChI:InChI=1/C5H11NO2.ClH/c1-2-4(6)3-5(7)8;/h4H,2-3,6H2,1H3,(H,7,8);1H
SMILES:CCC(CC(=O)O)N.Cl
Synonyms:- 3-Aminopentanoic acid hydrochloride (1:1)
- Pentanoic acid, 3-amino-, hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-Amino-pentanoic acid hydrochloride
CAS:3-Amino-pentanoic acid hydrochloride is a glycine analog, which blocks the glycine receptor of the NMDA type and inhibits glutamate binding. 3-Amino-pentanoic acid hydrochloride has been shown to have synergistic interaction with aminooxyacetic acid, an inhibitor of the glycine transporter. This increases the concentration of glycine in the synapse and leads to an anticonvulsant effect. 3-Amino-pentanoic acid hydrochloride also interacts with γ-aminobutyric acid (GABA) receptors and taurine receptors, which may be due to its structural similarity to these compounds.Formula:C5H12ClNO2Purity:Min. 95%Molecular weight:153.61 g/mol
