CAS 809279-05-8
:2-ethylsulfonylpropanoic acid
Description:
2-Ethylsulfonylpropanoic acid is an organic compound characterized by the presence of a sulfonyl group attached to a propanoic acid backbone. It features a two-carbon ethyl group linked to the sulfur atom of the sulfonyl functional group, which contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. The sulfonyl group enhances the compound's reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, 2-ethylsulfonylpropanoic acid may exhibit biological activity, which could be of interest in medicinal chemistry. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled.
Formula:C5H10O4S
InChI:InChI=1/C5H10O4S/c1-3-10(8,9)4(2)5(6)7/h4H,3H2,1-2H3,(H,6,7)
SMILES:CCS(=O)(=O)C(C)C(=O)O
Synonyms:- 2-(Ethylsulfonyl)Propanoic Acid
- Propanoic Acid, 2-(Ethylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
