CymitQuimica logo

CAS 809282-30-2

:

(βR,γZ)-γ-Ethylidene-3-methoxy-N,N,β-trimethylbenzenepropanamine

Description:
The chemical substance known as (βR,γZ)-γ-Ethylidene-3-methoxy-N,N,β-trimethylbenzenepropanamine, with the CAS number 809282-30-2, is a complex organic compound characterized by its unique structural features. It contains a propanamine backbone, which is substituted with an ethylidene group and a methoxy group, contributing to its reactivity and potential applications in various chemical processes. The presence of multiple methyl groups on the benzene ring enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. The stereochemistry indicated by the βR and γZ designations suggests specific spatial arrangements of atoms, which can significantly affect the compound's biological activity and pharmacological properties. Such compounds are often studied for their potential use in medicinal chemistry, particularly in the development of pharmaceuticals. Overall, the intricate structure of this compound suggests a range of possible applications, although specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization.
Formula:C15H23NO
InChI:InChI=1S/C15H23NO/c1-6-15(12(2)11-16(3)4)13-8-7-9-14(10-13)17-5/h6-10,12H,11H2,1-5H3/b15-6-/t12-/m0/s1
InChI key:InChIKey=JHKJGWJFBYPMCY-CJTQKWKHSA-N
SMILES:C(\[C@H](CN(C)C)C)(=C/C)/C1=CC(OC)=CC=C1
Synonyms:
  • Benzenepropanamine, γ-ethylidene-3-methoxy-N,N,β-trimethyl-, (βR,γZ)-
  • (βR,γZ)-γ-Ethylidene-3-methoxy-N,N,β-trimethylbenzenepropanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.