CymitQuimica logo

CAS 809282-47-1

:

(βR,γS)-γ-Ethyl-3-methoxy-N,N,β-trimethylbenzenepropanamine

Description:
The chemical substance known as (βR,γS)-γ-Ethyl-3-methoxy-N,N,β-trimethylbenzenepropanamine, with the CAS number 809282-47-1, is a chiral amine characterized by its complex structure, which includes a propanamine backbone and multiple substituents. This compound features a methoxy group and a trimethylbenzene moiety, contributing to its unique properties. As a chiral molecule, it exists in specific stereoisomeric forms, which can influence its biological activity and interactions. The presence of the ethyl group and the methoxy substituent may enhance its lipophilicity, potentially affecting its solubility and permeability in biological systems. Such compounds are often of interest in medicinal chemistry for their potential therapeutic applications, particularly in the development of pharmaceuticals. The specific stereochemistry (βR,γS) indicates the spatial arrangement of atoms, which is crucial for understanding the compound's reactivity and biological function. Overall, this substance exemplifies the complexity and diversity of organic compounds in chemical research.
Formula:C15H25NO
InChI:InChI=1S/C15H25NO/c1-6-15(12(2)11-16(3)4)13-8-7-9-14(10-13)17-5/h7-10,12,15H,6,11H2,1-5H3/t12-,15-/m0/s1
InChI key:InChIKey=JKVBTSJLQLSTHJ-WFASDCNBSA-N
SMILES:[C@@H]([C@H](CN(C)C)C)(CC)C1=CC(OC)=CC=C1
Synonyms:
  • Benzenepropanamine, γ-ethyl-3-methoxy-N,N,β-trimethyl-, (βR,γS)-
  • (βR,γS)-γ-Ethyl-3-methoxy-N,N,β-trimethylbenzenepropanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.