CAS 80937-31-1
:Flosulide
Description:
Flosulide, with the CAS number 80937-31-1, is a chemical compound that belongs to the class of sulfonamides. It is primarily recognized for its application in the field of pharmaceuticals, particularly as an anti-inflammatory and analgesic agent. The compound exhibits a unique structure that contributes to its biological activity, often characterized by the presence of a sulfonamide functional group, which is known for its ability to inhibit certain enzymes and modulate biological pathways. Flosulide is typically administered in specific dosages to achieve therapeutic effects while minimizing potential side effects. Its solubility, stability, and reactivity can vary based on environmental conditions, making it essential to consider these factors during formulation and storage. Additionally, safety data sheets and regulatory guidelines provide crucial information regarding handling, toxicity, and environmental impact, ensuring safe usage in both clinical and research settings. Overall, Flosulide represents a significant compound in medicinal chemistry, contributing to advancements in treatment options for various inflammatory conditions.
Formula:C16H13F2NO4S
InChI:InChI=1/C16H13F2NO4S/c1-24(21,22)19-13-6-9-2-4-14(20)11(9)8-16(13)23-15-5-3-10(17)7-12(15)18/h3,5-8,19H,2,4H2,1H3
SMILES:CS(=O)(=O)Nc1cc2CCC(=O)c2cc1Oc1ccc(cc1F)F
Synonyms:- Flosulide [INN]
- Cgp 28238
- Flosulida
- Flosulida [INN-Spanish]
- Flosulidum
- Flosulidum [INN-Latin]
- N-(6-(2,4-Difluorophenoxy)-1-oxo-5-indanyl)methanesulfonamide
- Unii-Gvr41S4Zhj
- N-[6-(2,4-difluorophenoxy)-1-oxo-2,3-dihydro-1H-inden-5-yl]methanesulfonamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Flosulide
CAS:<p>Flosulide is a novel, non-steroidal anti-inflammatory drug that has been shown to have inhibitory properties in vitro. Flosulide is a prodrug that is converted into the active form flosulide hydrochloride in vivo. The binding of flosulide to its receptor cb2 prevents the production of arachidonic acid, which would otherwise be metabolized into inflammatory prostaglandins (e.g., thromboxane). Flosulide also inhibits the production of epidermal growth factor (EGF) and glomerular filtration rate (GFR). This drug has long-term efficacy and can be used for treatment of metabolic disorders such as diabetes mellitus.</p>Formula:C16H13F2NO4SPurity:Min. 95%Molecular weight:353.3 g/molFlosulide
CAS:Flosulide is an effective selective COX-2 inhibitor for the treatment of inflammatory diseases.Formula:C16H13F2NO4SPurity:98%Color and Shape:SolidMolecular weight:353.34

