CAS 80943-05-1
:des-pro2-bradykinin
Description:
Des-Arg^2-bradykinin, also known as des-pro^2-bradykinin, is a peptide that is a derivative of bradykinin, a potent vasodilator involved in various physiological processes, including inflammation and blood pressure regulation. This substance is characterized by its specific amino acid sequence, which lacks the proline residue at the second position, distinguishing it from its parent compound. Des-Arg^2-bradykinin primarily acts on the B2 bradykinin receptor, contributing to its biological effects, which include increased vascular permeability and smooth muscle contraction. It is often studied in the context of cardiovascular research and inflammatory responses. The CAS number 80943-05-1 uniquely identifies this compound in chemical databases, facilitating its recognition and study in scientific literature. As a peptide, it is typically synthesized through solid-phase peptide synthesis or recombinant DNA technology, and its stability and activity can be influenced by factors such as pH and temperature. Understanding its characteristics is crucial for exploring its potential therapeutic applications and mechanisms of action in various biological systems.
Formula:C45H66N14O10
InChI:InChI=1/C45H66N14O10/c46-29(15-7-19-51-44(47)48)41(66)58-21-9-17-34(58)39(64)53-25-36(61)54-31(23-27-11-3-1-4-12-27)37(62)57-33(26-60)42(67)59-22-10-18-35(59)40(65)56-32(24-28-13-5-2-6-14-28)38(63)55-30(43(68)69)16-8-20-52-45(49)50/h1-6,11-14,29-35,60H,7-10,15-26,46H2,(H,53,64)(H,54,61)(H,55,63)(H,56,65)(H,57,62)(H,68,69)(H4,47,48,51)(H4,49,50,52)/t29-,30-,31-,32-,33-,34-,35-/m0/s1
SMILES:c1ccc(cc1)C[C@@H](C(=N[C@@H](CO)C(=O)N1CCC[C@H]1C(=N[C@@H](Cc1ccccc1)C(=N[C@@H](CCCNC(=N)N)C(=O)O)O)O)O)N=C(CN=C([C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)N)O)O
Synonyms:- H-Arg-Pro-Gly-Phe-Ser-Pro-Phe-Arg-OH
- N~5~-(diaminomethylidene)-L-ornithyl-L-prolylglycyl-L-phenylalanyl-L-seryl-L-prolyl-L-phenylalanyl-N~5~-(diaminomethylidene)-L-ornithine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Des-Pro2-Bradykinin
CAS:<p>Des-Pro2-Bradykinin is a synthetic peptide that has been shown to be an activator of ion channels, which are proteins that regulate the flow of ions across the cell membrane. Des-Pro2-Bradykinin can also inhibit the binding of ligands (e.g., neurotransmitters) to their receptors and can activate certain G protein coupled receptors. The inhibition of these interactions may have therapeutic potential for a variety of disorders, including pain and inflammation. Des-Pro2-Bradykinin is also an inhibitor of protein interactions with antibodies or ligands and is a pharmacological tool for research in cell biology, pharmacology, and life science.</p>Formula:C45H66N14O10Purity:Min. 95%Molecular weight:963.09 g/mol
