CAS 80944-48-5
:2-Propyl-4-pyridinecarboxamide
Description:
2-Propyl-4-pyridinecarboxamide, with the CAS number 80944-48-5, is an organic compound characterized by its pyridine ring structure substituted with a propyl group and a carboxamide functional group. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents due to the presence of the amide group, which can engage in hydrogen bonding. The pyridine ring contributes to its aromatic character and may influence its reactivity and interaction with biological systems. The presence of the propyl group can affect the compound's lipophilicity, potentially enhancing its ability to penetrate biological membranes. In terms of applications, compounds like 2-Propyl-4-pyridinecarboxamide may be explored for their pharmacological properties, including potential roles in medicinal chemistry or as intermediates in organic synthesis. Its specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods and can vary based on purity and environmental conditions.
Formula:C9H12N2O
InChI:InChI=1/C9H12N2O/c1-2-3-8-6-7(9(10)12)4-5-11-8/h4-6H,2-3H2,1H3,(H2,10,12)
InChI key:InChIKey=OGXRHACCPMCVIC-UHFFFAOYSA-N
SMILES:C(CC)C1=CC(C(N)=O)=CC=N1
Synonyms:- 2-Propyl-4-pyridinecarboxamide
- 2-Propylpyridine-4-Carboxamide
- 4-Pyridinecarboxamide, 2-propyl-
- Isonicotinamide, 2-propyl-
- 2-Propylisonicotinamide
- 2-Propylpyridin-4-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

