CAS 80945-82-0

5-Benzothiazolamine, 2-chloro-

Description:

5-Benzothiazolamine, 2-chloro- is an organic compound characterized by the presence of a benzothiazole ring, which is a bicyclic structure containing both a benzene and a thiazole moiety. The compound features an amino group (-NH2) at the 5-position of the benzothiazole and a chlorine atom at the 2-position, contributing to its reactivity and potential applications. It is typically a solid at room temperature and may exhibit properties such as solubility in polar solvents, depending on the specific functional groups present. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and ability to act as a building block in synthetic chemistry. Safety data should be consulted, as halogenated compounds can exhibit toxicity or environmental concerns. Overall, 5-Benzothiazolamine, 2-chloro- represents a class of compounds that can be explored for their chemical reactivity and utility in diverse applications.

Formula: C₇H₅ClN₂S

InChI: InChI=1/C7H5ClN2S/c8-7-10-5-3-4(9)1-2-6(5)11-7/h1-3H,9H2

SMILES: c1cc2c(cc1N)nc(Cl)s2

Synonyms:

• 2-Chloro-1,3-benzothiazol-5-amine
• 5-benzothiazolamine, 2-chloro-

5-Amino-2-chlorobenzothiazole

CAS: 80945-82-0

Formula: C₇H₅ClN₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 184.6460

Ref: IN-DA003GYD

5-Amino-2-chlorobenzothiazole

CAS: 80945-82-0

5-Amino-2-chlorobenzothiazole

Purity: 98%

Molecular weight: 184.65g/mol

Ref: 54-OR300771

5-Amino-2-chlorobenzothiazole

CAS: 80945-82-0

Formula: C₇H₅ClN₂S

Purity: 98%

Color and Shape: Solid, Yellow powder

Molecular weight: 184.64

Ref: 10-F077304