CAS 80970-04-3

N-(2-benzyl-3-sulfanylpropanoyl)-L-leucine

Description:

N-(2-benzyl-3-sulfanylpropanoyl)-L-leucine, with the CAS number 80970-04-3, is a synthetic compound that belongs to the class of amino acid derivatives. This substance features a leucine backbone, which is an essential amino acid known for its role in protein synthesis and metabolism. The presence of a benzyl group and a sulfanyl (thiol) functional group contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. The compound may exhibit characteristics typical of both amino acids and thiols, such as the ability to participate in redox reactions due to the thiol group. Additionally, the benzyl moiety may enhance lipophilicity, affecting the compound's solubility and permeability in biological systems. Such structural features suggest potential applications in pharmaceuticals, particularly in drug design and development, where modifications to amino acids can lead to novel therapeutic agents. However, specific biological activities and interactions would require further investigation through experimental studies.

Formula: C₁₆H₂₃NO₃S

InChI: InChI=1/C16H23NO3S/c1-11(2)8-14(16(19)20)17-15(18)13(10-21)9-12-6-4-3-5-7-12/h3-7,11,13-14,21H,8-10H2,1-2H3,(H,17,18)(H,19,20)/t13?,14-/m0/s1

Leucine thiorphan

CAS: 80970-04-3

Leucine thiorphan is an inhibitor of enkephalinase.

Formula: C₁₆H₂₃NO₃S

Purity: 98%

Color and Shape: Solid

Molecular weight: 309.42

Ref: TM-T25676