CAS 80985-34-8

6,7-bis(chloromethyl)-2,3-dihydro-1,4-benzodioxine

Description:

6,7-bis(chloromethyl)-2,3-dihydro-1,4-benzodioxine is an organic compound characterized by its unique structure, which includes a benzodioxine core with chloromethyl substituents at the 6 and 7 positions. This compound typically exhibits properties associated with halogenated organic compounds, such as increased reactivity due to the presence of chlorine atoms. It may be a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. The presence of the dioxine ring suggests potential applications in organic synthesis and materials science, although its chloromethyl groups may also impart toxicity and environmental concerns. As with many chlorinated compounds, it may undergo various chemical reactions, including nucleophilic substitution and electrophilic aromatic substitution. Safety precautions are essential when handling this substance due to its potential hazards. Overall, 6,7-bis(chloromethyl)-2,3-dihydro-1,4-benzodioxine is a compound of interest in chemical research, particularly in the fields of medicinal chemistry and synthetic organic chemistry.

Formula: C₁₀H₁₀Cl₂O₂

InChI: InChI=1/C10H10Cl2O2/c11-5-7-3-9-10(4-8(7)6-12)14-2-1-13-9/h3-4H,1-2,5-6H2