CAS 80996-23-2
:(1S)-5,12-dihydroxy-3-(hydroxyacetyl)-10-methoxy-6,11-dioxo-1,2,6,11-tetrahydrotetracen-1-yl 3-amino-2,3,6-trideoxy-alpha-L-lyxo-hexopyranoside
Description:
The chemical substance known as (1S)-5,12-dihydroxy-3-(hydroxyacetyl)-10-methoxy-6,11-dioxo-1,2,6,11-tetrahydrotetracen-1-yl 3-amino-2,3,6-trideoxy-alpha-L-lyxo-hexopyranoside, with the CAS number 80996-23-2, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as hydroxyl (-OH), methoxy (-OCH3), and amino (-NH2) groups. This compound features a tetracene backbone, which contributes to its potential biological activity and interaction with various biological systems. The presence of hydroxyl and amino groups suggests that it may exhibit polar characteristics, influencing its solubility and reactivity. Additionally, the compound's structure indicates potential for hydrogen bonding, which could play a role in its biological interactions. Such compounds are often of interest in medicinal chemistry and pharmacology due to their potential therapeutic applications, although specific biological activities and mechanisms would require further investigation through experimental studies.
Formula:C27H27NO10
InChI:InChI=1/C27H27NO10/c1-10-23(31)14(28)8-18(37-10)38-17-7-11(15(30)9-29)6-13-20(17)27(35)22-21(25(13)33)24(32)12-4-3-5-16(36-2)19(12)26(22)34/h3-6,10,14,17-18,23,29,31,33,35H,7-9,28H2,1-2H3/t10-,14-,17-,18-,23+/m0/s1
Synonyms:- 5,12-Naphthacenedione, 10-((3-amino-2,3,6-trideoxy-alpha-L-lyxo-hexopyranosyl)oxy)-9,10-dihydro-6,11-dihydroxy-8-(hydroxyacetyl)-1-methoxy-, (S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
9,10-Anhydro doxorubicin
CAS:<p>Please enquire for more information about 9,10-Anhydro doxorubicin including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C27H27NO10Molecular weight:525.5 g/mol



