CAS 80997-89-3
:4-bromo-2-(trifluoromethyl)aniline hydrochloride,
Description:
4-Bromo-2-(trifluoromethyl)aniline hydrochloride is an organic compound characterized by the presence of a bromine atom and a trifluoromethyl group attached to an aniline structure. This compound features a benzene ring with an amino group (-NH2) that is substituted at the para position by a bromine atom and at the ortho position by a trifluoromethyl group (-CF3). The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications in organic synthesis and pharmaceutical research. The trifluoromethyl group contributes to the compound's lipophilicity and can influence its biological activity. Additionally, the presence of the bromine atom may impart unique reactivity, making it useful in further chemical transformations. As with many halogenated compounds, safety precautions should be observed due to potential toxicity and environmental impact. Overall, 4-bromo-2-(trifluoromethyl)aniline hydrochloride is a valuable compound in the field of medicinal chemistry and materials science.
Formula:C7H6BrClF3N
InChI:InChI=1/C7H5BrF3N.ClH/c8-4-1-2-6(12)5(3-4)7(9,10)11;/h1-3H,12H2;1H
SMILES:c1cc(c(cc1Br)C(F)(F)F)N.Cl
Synonyms:- 4-Bromo-2-(Trifluoromethyl)Aniline Hydrochloride (1:1)
- 4-Bromo-2-(trifluoromethyl)aniline hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Amino-5-bromobenzotrifluoride hydrochloride
CAS:2-Amino-5-bromobenzotrifluoride hydrochloride
Molecular weight:276.48145g/mol

