CAS 81-06-1

1-Naphthylamine-2-sulfonic acid

Description:

1-Naphthylamine-2-sulfonic acid, with the CAS number 81-06-1, is an organic compound characterized by its naphthalene structure substituted with an amino group and a sulfonic acid group. This compound appears as a solid, typically in a crystalline form, and is known for its solubility in water due to the presence of the sulfonic acid group, which enhances its polar characteristics. It is primarily used in the dye industry, particularly in the synthesis of azo dyes, and serves as a reagent in various chemical reactions. The amino group contributes to its basicity, while the sulfonic acid group imparts acidic properties, making it a zwitterionic compound under certain conditions. Additionally, 1-naphthylamine-2-sulfonic acid is recognized for its role in analytical chemistry, particularly in colorimetric assays. Safety considerations are important, as it may pose health risks, including potential carcinogenic effects, necessitating proper handling and disposal protocols in laboratory settings.

Formula: C₁₀H₉NO₃S

InChI: InChI=1S/C10H9NO3S/c11-10-8-4-2-1-3-7(8)5-6-9(10)15(12,13)14/h1-6H,11H2,(H,12,13,14)

InChI key: InChIKey=ONZWNZGVZFLMNZ-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)C1=C(N)C2=C(C=C1)C=CC=C2

Synonyms:

• 1-Naphthylamine-2-sulfonic acid
• 2-Naphthalenesulfonic acid, 1-amino-
• 1-aminonaphthalene-2-sulfonic acid
• 1-Amino-2-naphthalenesulfonic acid
• 1-Amino-2-naphthalenesulfonic acid
• α-Naphthylamine-2-sulfonic acid
• 1-Aminonaphthalene-2-sulphonic acid