CAS 81-94-7
:1-[(7-Oxo-7H-benz[de]anthracen-3-yl)amino]-9,10-anthracenedione
Description:
1-[(7-Oxo-7H-benz[de]anthracen-3-yl)amino]-9,10-anthracenedione, commonly known as anthraquinone derivative, is a chemical compound characterized by its complex polycyclic structure, which includes multiple fused aromatic rings. This compound exhibits a deep color, often associated with its use as a dye or pigment. It is known for its potential applications in various fields, including organic electronics, photodynamic therapy, and as a precursor in the synthesis of other organic compounds. The presence of both amino and carbonyl functional groups contributes to its reactivity, allowing for various chemical transformations. Additionally, its planar structure enhances its ability to intercalate with DNA, which has implications in medicinal chemistry and cancer research. The compound is typically insoluble in water but may dissolve in organic solvents, reflecting its hydrophobic nature. Safety data indicates that it should be handled with care due to potential toxicity and environmental impact. Overall, this compound is of interest for its unique properties and versatility in chemical applications.
Formula:C31H17NO3
InChI:InChI=1S/C31H17NO3/c33-29-19-8-2-1-7-17(19)18-15-16-25(22-11-5-12-23(29)27(18)22)32-26-14-6-13-24-28(26)31(35)21-10-4-3-9-20(21)30(24)34/h1-16,32H
InChI key:InChIKey=IYIHHRQMVJYLAX-UHFFFAOYSA-N
SMILES:N(C1=C2C3=C(C=4C(C(=O)C3=CC=C2)=CC=CC4)C=C1)C5=C6C(C(=O)C=7C(C6=O)=CC=CC7)=CC=C5
Synonyms:- NSC 13987
- 1-[(7-Oxo-7H-benz[de]anthracen-3-yl)amino]-9,10-anthracenedione
- 7H-Benz[de]anthracene, 9,10-anthracenedione deriv.
- Anthraquinone, 1-[(7-oxo-7H-benz[de]anthracen-3-yl)amino]-
- 9,10-Anthracenedione, 1-[(7-oxo-7H-benz[de]anthracen-3-yl)amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
