CAS 81010-24-4
:Ethyl 4-(4-bromophenyl)-4-hydroxy-1-piperidinecarboxylate
Description:
Ethyl 4-(4-bromophenyl)-4-hydroxy-1-piperidinecarboxylate, with the CAS number 81010-24-4, is a chemical compound characterized by its piperidine structure, which includes a carboxylate functional group and a bromophenyl substituent. This compound typically exhibits properties associated with both the piperidine and ester functional groups, such as moderate solubility in organic solvents and potential reactivity due to the presence of the hydroxyl and bromine substituents. The bromine atom can influence the compound's electronic properties and reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. The presence of the ethyl ester group suggests that it may participate in esterification or hydrolysis reactions. Additionally, the compound may exhibit biological activity, which is common among piperidine derivatives, potentially making it of interest in medicinal chemistry. Overall, its unique structure and functional groups contribute to its chemical behavior and potential applications in research and industry.
Formula:C14H18BrNO3
InChI:InChI=1S/C14H18BrNO3/c1-2-19-13(17)16-9-7-14(18,8-10-16)11-3-5-12(15)6-4-11/h3-6,18H,2,7-10H2,1H3
InChI key:InChIKey=ZHNGYEXRMKGVBY-UHFFFAOYSA-N
SMILES:OC1(C2=CC=C(Br)C=C2)CCN(C(OCC)=O)CC1
Synonyms:- Ethyl 4-(4-bromophenyl)-4-hydroxypiperidine-1-carboxylate
- 1-Piperidinecarboxylic acid, 4-(4-bromophenyl)-4-hydroxy-, ethyl ester
- Ethyl 4-(4-bromophenyl)-4-hydroxy-1-piperidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.