CAS 81012-87-5
:Cytidine-5'-triphosphate disodium salt dihydrate
Description:
Cytidine-5'-triphosphate disodium salt dihydrate (CTP) is a nucleotide that plays a crucial role in cellular metabolism and is involved in various biochemical processes, including RNA synthesis and energy transfer. It consists of a cytosine base, a ribose sugar, and three phosphate groups, which contribute to its high-energy properties. The disodium salt form enhances its solubility in aqueous solutions, making it suitable for laboratory applications. As a dihydrate, it contains two water molecules per formula unit, which can influence its stability and solubility characteristics. CTP is essential for the synthesis of RNA during transcription and is also a substrate for the synthesis of phospholipids and other nucleotides. In terms of stability, it is generally stable under physiological conditions but can be hydrolyzed in the presence of nucleotidases. CTP is utilized in various biochemical assays and research applications, particularly in studies related to nucleic acid metabolism and cellular signaling pathways.
Formula:C9H12N3O14P3
InChI:InChI=1/C9H16N3O14P3/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(24-8)3-23-28(19,20)26-29(21,22)25-27(16,17)18/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H,21,22)(H2,10,11,15)(H2,16,17,18)/p-4/t4-,6-,7-,8-/m1/s1
SMILES:c1cn([C@H]2[C@@H]([C@@H]([C@@H](COP(=O)([O-])OP(=O)(O)OP(=O)([O-])[O-])O2)O)O)c(nc1=N)[O-]
Synonyms:- 5'-O-({[(phosphonatooxy)phosphinato]oxy}phosphinato)cytidine
- CTP,100mM Solution
- Cytidine Triphosphate Disodium
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Cytidine 5′-triphosphate disodium salt
CAS:Formula:C9H18N3Na2O16P3Purity:95%Color and Shape:SolidMolecular weight:563.1505Cytidine-5'-Triphosphate disodium salt dihydrate
CAS:Cytidine-5'-Triphosphate disodium salt dihydratePurity:97.5% (Typical Value in Batch COA)Color and Shape: white solidMolecular weight:0.00g/molCTP disodium dihydrate
CAS:CTP disodium dihydrate is an agonist of P2X4 purinergic receptor
Formula:C9H18N3Na2O16P3Purity:98.51%Color and Shape:White Crystalline PowderMolecular weight:563.15Cytidine 5’-triphosphate disodium salt dihydrate
CAS:Formula:C9H16N3O14P3Na2Purity:≥ 96.0%Color and Shape:Colourless crystals or white powderMolecular weight:529.14Sodium ((2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1(2H)-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl dihydrogentriphosphate dihydrate
CAS:Purity:95%Molecular weight:562.97Cytidine 5'-triphosphate disodium dihydrate
CAS:Cytidine 5'-triphosphate (CTP) disodium dihydrate prevents the action of aspartate carbamoyltransferase, an enzyme involved in pyrimidine biosynthesis. CTP serves as a molecule of high energy and acts as a coenzyme in glycerophospholipid biosynthesis and protein glycosylation.Formula:C9H16N3O14P3•(H2O)2•Na2Purity:Min. 95%Color and Shape:PowderMolecular weight:565.17 g/molCytidine-5-Triphosphate Disodium Salt Dihydrate (5-CTP.Na2) extrapure, 97%
CAS:Formula:C9H18N3Na2O16P3Purity:min. 97.0%Color and Shape:White, Crystalline hygroscopic powder, Clear, ColourlessMolecular weight:563.15







