CAS 81012-91-1

N-(gamma-L-Glutamyl)-alpha-naphthylamide monohydrate

Description:

N-(gamma-L-Glutamyl)-alpha-naphthylamide monohydrate is a chemical compound characterized by its structure, which includes a gamma-L-glutamyl group linked to an alpha-naphthylamide moiety. This compound is typically used in biochemical applications, particularly in enzyme assays and as a substrate for various enzymes, such as aminopeptidases. It is known for its ability to undergo hydrolysis, releasing the naphthylamine derivative, which can be detected spectrophotometrically. The monohydrate form indicates the presence of one water molecule associated with each molecule of the compound, which can influence its solubility and stability. In terms of physical properties, it is generally a white to off-white solid, soluble in water and organic solvents to varying degrees. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken. Overall, N-(gamma-L-Glutamyl)-alpha-naphthylamide monohydrate serves as a valuable tool in biochemical research and analysis.

Formula: C₁₅H₁₆N₂O₃

InChI: InChI=1/C15H16N2O3/c16-12(15(19)20)8-9-14(18)17-13-7-3-5-10-4-1-2-6-11(10)13/h1-7,12H,8-9,16H2,(H,17,18)(H,19,20)/t12-/m0/s1

SMILES: c1ccc2c(c1)cccc2N=C(CC[C@@H](C(=O)O)N)O

Synonyms:

• N-naphthalen-1-yl-L-glutamine

N-(γ-L-GLUTAMYL)-α-NAPHTHYLAMIDE MONOHYDRATE

CAS: 81012-91-1

Formula: C₁₆H₁₈N₂O₅

Purity: 98%

Molecular weight: 318.3245

Ref: IN-DA0056M4

γ-L-Glutamyl-α-naphthylamide monohydrate

CAS: 81012-91-1

Gamma-L-glutamyl-alpha-naphthylamide is an enzyme that catalyzes the conversion of L-glutamic acid to L-glutamate. It is expressed in red blood cells, human liver, and human serum. Gamma-L-glutamyl-alpha-naphthylamide has been shown to have various specificities for different tissues and isoenzymes. This enzyme also has immunoassay procedures that are used to detect it in tissues or cells. These assays use monoclonal antibodies or solubilized gamma-L-glutamyl-alpha-naphthylamide molecules as detection agents.

Formula: C₁₅H₁₆N₂O₃•H₂O

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 290.31 g/mol

Ref: 3D-EG68009