CAS 81013-00-5
:Hexanamide, 2-(acetylamino)-6-amino-N-methyl-, monohydrate, (S)-
Description:
Hexanamide, 2-(acetylamino)-6-amino-N-methyl-, monohydrate, (S)-, is a chemical compound characterized by its amide functional group, which is indicative of its potential as a polar molecule. The presence of both acetylamino and amino groups suggests that it may exhibit significant hydrogen bonding capabilities, influencing its solubility and reactivity. As a monohydrate, it contains one molecule of water per molecule of the compound, which can affect its stability and crystallization properties. The (S)- designation indicates that it has a specific stereochemistry, which can be crucial for its biological activity and interactions in pharmaceutical applications. This compound may be utilized in various fields, including medicinal chemistry, due to its potential role as a building block in drug synthesis or as a bioactive agent. Its molecular structure likely contributes to its specific interactions with biological targets, making it of interest in research and development. Overall, the characteristics of this compound suggest a complex interplay of physical and chemical properties that can be leveraged in various applications.
Formula:C9H19N3O2·H2O
InChI:InChI=1S/C9H19N3O2.H2O/c1-7(13)12-8(9(14)11-2)5-3-4-6-10;/h8H,3-6,10H2,1-2H3,(H,11,14)(H,12,13);1H2/t8-;/m0./s1
InChI key:InChIKey=UEYQZUVXGKIRDT-QRPNPIFTSA-N
SMILES:[C@H](C(NC)=O)(NC(C)=O)CCCCN.O
Synonyms:- Hexanamide, 2-(acetylamino)-6-amino-N-methyl-, monohydrate, (S)-
- N-ALPHA-ACETYL-L-LYSINE-N-METHYLAMIDE MONOHYDRATE
- N-ALPHA-ACETYL-L-LYSINE-N-METHYLAMIDE 1-HYDRATE
- N-Alpha-acetyl-l-lysine-n-methylamide monohydrate, 99+%
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
