CymitQuimica logo

CAS 81018-83-9

:

9-(N-Methyl-2-aminoheptanoic acid)mycoplanecin A

Description:
9-(N-Methyl-2-aminoheptanoic acid)mycoplanecin A, with the CAS number 81018-83-9, is a complex organic compound that belongs to the class of mycoplanecins, which are known for their antibiotic properties. This substance features a unique structure that includes a mycoplanecin backbone, characterized by a cyclic structure and a side chain containing an N-methyl-2-aminoheptanoic acid moiety. The presence of the amino acid derivative contributes to its biological activity, potentially enhancing its interaction with bacterial targets. Mycoplanecins, including this compound, are typically produced by certain strains of bacteria and exhibit activity against a range of Gram-positive bacteria. The compound's specific stereochemistry and functional groups play a crucial role in its pharmacological properties, influencing its solubility, stability, and mechanism of action. As with many bioactive compounds, further research is essential to fully understand its therapeutic potential and the mechanisms underlying its antibiotic effects.
Formula:C62H104N10O13
InChI:InChI=1/C62H104N10O13/c1-18-21-22-24-44-53(75)63-32-49(74)85-40(13)52(69(17)59(81)47-31-41(19-2)34-72(47)62(84)51(38(10)11)68(16)60(82)48(73)20-3)55(77)65-43(29-36(6)7)57(79)71-33-39(12)30-46(71)54(76)64-42(27-26-35(4)5)56(78)67(15)50(37(8)9)61(83)70-28-23-25-45(70)58(80)66(44)14/h35-47,50-52H,18-34H2,1-17H3,(H,63,75)(H,64,76)(H,65,77)
Synonyms:
  • 9-(N-Methyl-2-aminoheptanoic acid)mycoplanecin A
  • Mycoplanecin C
  • Mycoplanecin C (9CI)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.