CAS 81022-05-1

Ethyl 7-chloroimidazo[2,1-b]benzothiazole-2-carboxylate

Description:

Ethyl 7-chloroimidazo[2,1-b]benzothiazole-2-carboxylate is a chemical compound characterized by its complex heterocyclic structure, which includes both imidazole and benzothiazole moieties. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many heterocyclic compounds. The presence of the chloro substituent can influence its reactivity and biological activity, potentially enhancing its pharmacological properties. Ethyl 7-chloroimidazo[2,1-b]benzothiazole-2-carboxylate may be of interest in medicinal chemistry, particularly for its potential applications in drug development, as compounds with similar structures have been investigated for their antimicrobial and anticancer activities. Additionally, the carboxylate group can participate in various chemical reactions, making this compound versatile in synthetic chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₂H₉ClN₂O₂S

InChI: InChI=1S/C12H9ClN2O2S/c1-2-17-11(16)8-6-15-9-4-3-7(13)5-10(9)18-12(15)14-8/h3-6H,2H2,1H3

InChI key: InChIKey=VMTUPCLFULPHMX-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=CN2C=3C(SC2=N1)=CC(Cl)=CC3

Synonyms:

• NSC 703092
• Ethyl 7-chloroimidazo[2,1-b]benzothiazole-2-carboxylate
• Imidazo[2,1-b]benzothiazole-2-carboxylic acid, 7-chloro-, ethyl ester

7-Chloro-benzo[d]imidazo[2,1-b]thiazole-2-carboxylic acid ethyl ester

CAS: 81022-05-1

Purity: 95.0%

Molecular weight: 280.7300109863281

Ref: 10-F475659