CAS 81024-99-9
:ethyl alpha-D-fructofuranoside
Description:
Ethyl alpha-D-fructofuranoside is a glycoside derived from fructose, characterized by its ethyl ester group attached to the anomeric carbon of the fructofuranose structure. This compound is typically a white to off-white crystalline solid, soluble in water and various organic solvents, which makes it useful in biochemical applications. It has a sweet taste, similar to that of fructose, and is often utilized in food and beverage industries as a sweetener or flavoring agent. Ethyl alpha-D-fructofuranoside is stable under normal conditions but may undergo hydrolysis in the presence of strong acids or bases, leading to the release of fructose and ethanol. Its chemical structure contributes to its reactivity, allowing it to participate in various chemical reactions, including glycosylation and esterification. Additionally, it is important in research related to carbohydrate chemistry and can serve as a model compound for studying glycosidic bonds and their biological implications. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H16O6
InChI:InChI=1/C8H16O6/c1-2-13-8(4-10)7(12)6(11)5(3-9)14-8/h5-7,9-12H,2-4H2,1H3/t5-,6-,7+,8+/m1/s1
Synonyms:- alpha-D-fructofuranoside, ethyl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Ethyl a-D-fructofuranoside
CAS:<p>Ethyl a-D-fructofuranoside is a carbohydrate found in the roots of orientalis that has been shown to have anti-allergic effects. Ethyl a-D-fructofuranoside is extracted from the root of orientalis and purified by column chromatography. It inhibits histamine release and reduces inflammation in mouse skin tests. The structure of ethyl a-D-fructofuranoside was determined using nuclear magnetic resonance (NMR) spectroscopy, gas chromatography, and mass spectroscopy. The biosynthesis of this compound is unknown but it may be synthesized from sucrose or methanol extract with the help of an enzyme called verbascose synthase.</p>Formula:C8H16O6Purity:Min. 95%Molecular weight:208.21 g/mol

