CAS 81025-84-5
:2-oxa-5-azabicyclo[2.2.1]heptan-3-one
Description:
2-Oxa-5-azabicyclo[2.2.1]heptan-3-one, with the CAS number 81025-84-5, is a bicyclic compound featuring both oxygen and nitrogen in its structure. This compound is characterized by a bicyclic framework that includes a five-membered ring containing an oxygen atom and a six-membered ring that incorporates a nitrogen atom. The presence of the carbonyl group (ketone) at the 3-position contributes to its reactivity and potential applications in organic synthesis. The unique bicyclic structure can influence its physical properties, such as solubility and boiling point, and may also affect its biological activity, making it of interest in medicinal chemistry. Additionally, the compound's stereochemistry can play a significant role in its interactions with biological targets. Overall, 2-oxa-5-azabicyclo[2.2.1]heptan-3-one is a compound of interest for further research due to its structural complexity and potential utility in various chemical applications.
Formula:C5H7NO2
InChI:InChI=1/C5H7NO2/c7-5-4-1-3(8-5)2-6-4/h3-4,6H,1-2H2
SMILES:C1C2CNC1C(=O)O2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.