CymitQuimica logo

CAS 81036-52-4

:

(5R,6R)-3-[(3-aminopropyl)sulfanyl]-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid

Description:
The chemical substance known as (5R,6R)-3-[(3-aminopropyl)sulfanyl]-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid, with the CAS number 81036-52-4, is a bicyclic compound featuring a thiazolidine ring structure. This compound is characterized by the presence of a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The molecule contains a sulfenyl group, indicating the presence of sulfur, which may impart unique chemical properties such as nucleophilicity. Additionally, the presence of an amino group suggests potential for hydrogen bonding and interactions with biological systems, making it of interest in medicinal chemistry. The stereochemistry indicated by the (R) and (S) designations suggests specific spatial arrangements of atoms, which can significantly influence the compound's biological activity and interactions. Overall, this compound's unique structural features may contribute to its potential applications in pharmaceuticals or as a biochemical probe.
Formula:C11H16N2O4S2
InChI:InChI=1/C11H16N2O4S2/c1-5(14)6-8(15)13-7(10(16)17)11(19-9(6)13)18-4-2-3-12/h5-6,9,14H,2-4,12H2,1H3,(H,16,17)/t5-,6-,9-/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Sch 33440

    CAS:
    Sch 33440 is a bioactive chemical.
    Formula:C11H16N2O4S2
    Color and Shape:Solid
    Molecular weight:304.38

    Ref: TM-T34568

    25mg
    To inquire
    50mg
    To inquire
    100mg
    To inquire