CymitQuimica logo

CAS 81036-84-2

:

7-bromo-1,4-dioxaspiro[4.5]dec-7-ene

Description:
7-Bromo-1,4-dioxaspiro[4.5]dec-7-ene is a chemical compound characterized by its unique spirocyclic structure, which features a dioxane ring fused to a decene framework. The presence of a bromine atom at the 7-position contributes to its reactivity and potential applications in organic synthesis. This compound exhibits properties typical of spiro compounds, such as rigidity and a constrained conformation, which can influence its chemical behavior and interactions. The dioxaspiro structure may also impart specific solubility characteristics and stability under various conditions. Additionally, the compound's bromine substituent can facilitate electrophilic reactions, making it a valuable intermediate in the synthesis of more complex organic molecules. Its CAS number, 81036-84-2, allows for easy identification and retrieval of information in chemical databases. Overall, 7-bromo-1,4-dioxaspiro[4.5]dec-7-ene is of interest in the field of synthetic organic chemistry due to its distinctive structure and potential utility in various chemical reactions.
Formula:C8H11BrO2
InChI:InChI=1/C8H11BrO2/c9-7-2-1-3-8(6-7)10-4-5-11-8/h2H,1,3-6H2
SMILES:C1C=C(CC2(C1)OCCO2)Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.