
CAS 81053-26-1
:Aridanin
Description:
Aridanin, with the CAS number 81053-26-1, is a chemical compound that belongs to the class of natural products known as terpenoids. It is primarily derived from certain plant sources and is noted for its potential biological activities, including antimicrobial and anti-inflammatory properties. The molecular structure of Aridanin features a complex arrangement of carbon, hydrogen, and oxygen atoms, which contributes to its unique chemical behavior and interactions. This compound has garnered interest in the field of medicinal chemistry due to its potential therapeutic applications. However, detailed studies on its pharmacokinetics, toxicity, and specific mechanisms of action are still ongoing. As with many natural products, the extraction and purification processes can significantly influence its availability and efficacy. Overall, Aridanin represents a fascinating area of study within natural product chemistry, with implications for drug development and therapeutic use.
Formula:C38H61NO8
InChI:InChI=1S/C38H61NO8/c1-21(41)39-28-30(43)29(42)24(20-40)46-31(28)47-27-12-13-35(6)25(34(27,4)5)11-14-37(8)26(35)10-9-22-23-19-33(2,3)15-17-38(23,32(44)45)18-16-36(22,37)7/h9,23-31,40,42-43H,10-20H2,1-8H3,(H,39,41)(H,44,45)/t23-,24+,25-,26+,27-,28+,29+,30+,31-,35-,36+,37+,38-/m0/s1
InChI key:InChIKey=VRFWJSCLROXBBW-FUHHSGJXSA-N
SMILES:C[C@]12[C@@]3(C)C([C@]4([C@@](C(O)=O)(CC3)CCC(C)(C)C4)[H])=CC[C@@]1([C@]5(C)[C@@](CC2)(C(C)(C)[C@@H](O[C@H]6[C@H](NC(C)=O)[C@@H](O)[C@H](O)[C@@H](CO)O6)CC5)[H])[H]
Synonyms:- (3β)-3-[[2-(Acetylamino)-2-deoxy-β-D-glucopyranosyl]oxy]olean-12-en-28-oic acid
- Aridanin
- 3-O-(2-Acetamido-2-deoxy-β-D-glucopyranosyl)oleanolic acid
- Olean-12-en-28-oic acid, 3-[[2-(acetylamino)-2-deoxy-β-D-glucopyranosyl]oxy]-, (3β)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Aridanin
CAS:<p>Aridanin is a useful organic compound for research related to life sciences. The catalog number is T124182 and the CAS number is 81053-26-1.</p>Formula:C38H61NO8Color and Shape:SolidMolecular weight:659.905
