CAS 81065-76-1

manganous 2-methoxy-6-[(E)-2-[(E)-(3-methoxy-2-oxido-phenyl)methyleneamino]ethyliminomethyl]phenolate chloride

Description:

Manganous 2-methoxy-6-[(E)-2-[(E)-(3-methoxy-2-oxido-phenyl)methyleneamino]ethyliminomethyl]phenolate chloride, identified by its CAS number 81065-76-1, is a complex organic compound that features a manganese ion coordinated with a phenolate ligand. This compound exhibits characteristics typical of metal-organic complexes, including potential catalytic activity and unique electronic properties due to the presence of the manganese ion. The structure includes methoxy groups, which can influence solubility and reactivity, and imine functionalities that may participate in various chemical reactions. The chloride ion likely serves as a counterion, contributing to the overall stability of the compound in solution. Such compounds may have applications in fields like coordination chemistry, materials science, or medicinal chemistry, particularly in the development of new therapeutic agents or catalysts. The specific interactions and reactivity of this compound would depend on its environment, including pH, solvent, and temperature, which can significantly affect its behavior and potential applications.

Formula: C₁₈H₁₈ClMnN₂O₄

InChI: InChI=1/C18H20N2O4.ClH.Mn/c1-23-15-7-3-5-13(17(15)21)11-19-9-10-20-12-14-6-4-8-16(24-2)18(14)22;;/h3-8,11-12,21-22H,9-10H2,1-2H3;1H;/q;;+2/p-3/b19-11+,20-12+;;

SMILES: COc1cccc(C=NCCN=Cc2cccc(c2O)OC)c1O.Cl.[Mn]

Synonyms:

• Salen-Mn

EUK 134

CAS: 81065-76-1

Formula: C₁₈H₁₈ClMn₃N₂O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 526.6137

Ref: IN-DA00562F

EUK-134

CAS: 81065-76-1

EUK-134

Purity: ≥98%

Molecular weight: 416.74g/mol

Ref: 54-BUP15663

EUK-134

CAS: 81065-76-1

EUK-134, a synthetic SOD/catalase mimetic, exhibits potent antioxidant activities, and inhibits the formation of β-amyloid and related amyloid fibril.

Formula: C₁₈H₁₈ClMnN₂O₄

Purity: 98.39%

Color and Shape: Solid

Molecular weight: 416.74

Ref: TM-T6495