CAS 81068-25-9

3-[2-(dimethylamino)ethoxy]benzaldehyde

Description:

3-[2-(Dimethylamino)ethoxy]benzaldehyde, with the CAS number 81068-25-9, is an organic compound characterized by its aromatic structure and functional groups. It features a benzaldehyde moiety, which is a benzene ring with an aldehyde (-CHO) group, and an ethoxy group that is substituted with a dimethylamino group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to the presence of the dimethylamino group, which can enhance reactivity and solubility. The compound may exhibit moderate to high polarity, influencing its solubility in various solvents. Additionally, it may possess biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₁H₁₅NO₂

InChI: InChI=1/C11H15NO2/c1-12(2)6-7-14-11-5-3-4-10(8-11)9-13/h3-5,8-9H,6-7H2,1-2H3

SMILES: CN(C)CCOc1cccc(c1)C=O

Synonyms:

• Benzaldehyde, 3-[2-(Dimethylamino)Ethoxy]-