CAS 81078-82-2
:6-methyl-4-(piperazin-1-yl)furo[3,2-c]pyridine
Description:
6-Methyl-4-(piperazin-1-yl)furo[3,2-c]pyridine is a heterocyclic compound characterized by its complex structure, which includes a fused furo and pyridine ring system. This compound features a methyl group at the 6-position and a piperazine moiety at the 4-position, contributing to its potential biological activity. The presence of the piperazine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's molecular structure may influence its solubility, stability, and reactivity, which are critical for its application in drug design. Additionally, the furo-pyridine framework can impart unique electronic properties, potentially affecting its pharmacokinetics and pharmacodynamics. As with many heterocycles, the compound may exhibit diverse biological activities, including antimicrobial, anti-inflammatory, or neuroactive properties, warranting further investigation in preclinical studies. Overall, 6-methyl-4-(piperazin-1-yl)furo[3,2-c]pyridine represents a promising scaffold for further exploration in drug discovery.
Formula:C12H15N3O
InChI:InChI=1/C12H15N3O/c1-9-8-11-10(2-7-16-11)12(14-9)15-5-3-13-4-6-15/h2,7-8,13H,3-6H2,1H3
Synonyms:- Furo(3,2-c)pyridine, 6-methyl-4-(1-piperazinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.