CAS 81099-48-1

2-chloro-N-(tricyclo[3.3.1.1~3,7~]dec-1-ylmethyl)acetamide

Description:

2-chloro-N-(tricyclo[3.3.1.1~3,7~]dec-1-ylmethyl)acetamide is a chemical compound characterized by its unique structural features, including a chloro substituent and a tricyclic framework. The presence of the chloro group indicates potential reactivity, particularly in nucleophilic substitution reactions. The tricyclo[3.3.1.1~3,7~]decane moiety contributes to the compound's rigidity and steric hindrance, which can influence its biological activity and interaction with other molecules. This compound is likely to exhibit moderate to low solubility in water due to its hydrophobic tricyclic structure, while its amide functional group may enhance its solubility in organic solvents. The acetamide portion suggests potential for hydrogen bonding, which can affect its physical properties and reactivity. Overall, the combination of these structural elements may confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Further studies would be necessary to elucidate its complete chemical behavior and potential applications.

Formula: C₁₃H₂₀ClNO

InChI: InChI=1/C13H20ClNO/c14-7-12(16)15-8-13-4-9-1-10(5-13)3-11(2-9)6-13/h9-11H,1-8H2,(H,15,16)

SMILES: C1C2CC3CC1CC(C2)(C3)CN=C(CCl)O

Synonyms:

• acetamide, 2-chloro-N-(tricyclo[3.3.1.1~3,7~]dec-1-ylmethyl)-
• N-(1-adamantylmethyl)-2-chloroacetamide