CAS 81102-44-5

2-Amino-8-bromoadenosine

Description:

2-Amino-8-bromoadenosine is a modified nucleoside that belongs to the class of purine derivatives. It features an amino group at the 2-position and a bromine atom at the 8-position of the adenine base, which alters its biological activity compared to unmodified adenosine. This compound is typically characterized by its ability to interact with adenosine receptors, potentially influencing various physiological processes such as neurotransmission and immune responses. The presence of the bromine atom can enhance its lipophilicity, affecting its membrane permeability and biological availability. Additionally, 2-amino-8-bromoadenosine may exhibit unique pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its structural modifications can lead to variations in stability, solubility, and reactivity, which are crucial for its application in research and therapeutic contexts. Overall, this compound serves as a valuable tool for studying adenosine-related pathways and may have implications in treating various diseases.

Formula: C₁₀H₁₃BrN₆O₄

InChI: InChI=1S/C10H13BrN6O4/c11-9-14-3-6(12)15-10(13)16-7(3)17(9)8-5(20)4(19)2(1-18)21-8/h2,4-5,8,18-20H,1H2,(H4,12,13,15,16)/t2-,4-,5-,8-/m1/s1

InChI key: InChIKey=RLIGCODAPNURDC-UMMCILCDSA-N

SMILES: BrC=1N(C=2C(N1)=C(N)N=C(N)N2)[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O

Synonyms:

• 2-Amino-8-bromoadenosine
• Adenosine, 2-amino-8-bromo-