CAS 81104-42-9

4-(Methylthio)benzhydrazide

Description:

4-(Methylthio)benzhydrazide is an organic compound characterized by its hydrazide functional group attached to a benzene ring, which is further substituted with a methylthio group. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. Its molecular structure includes a hydrazine moiety, which can participate in various chemical reactions, such as condensation and oxidation. The presence of the methylthio group enhances its reactivity and may influence its biological activity. 4-(Methylthio)benzhydrazide may exhibit properties such as solubility in organic solvents, while its stability can be affected by environmental conditions. Safety data indicates that, like many hydrazides, it should be handled with care due to potential toxicity and reactivity. Overall, this compound serves as a valuable intermediate in synthetic chemistry, contributing to the development of more complex molecules.

Formula: C₈H₁₀N₂OS

InChI: InChI=1/C8H10N2OS/c1-12-7-4-2-6(3-5-7)8(11)10-9/h2-5H,9H2,1H3,(H,10,11)

SMILES: CSc1ccc(cc1)C(=O)NN

Synonyms:

• 4-(Methylsulfanyl)Benzohydrazide

4-(METHYLTHIO)BENZHYDRAZIDE

CAS: 81104-42-9

Formula: C₈H₁₀N₂OS

Purity: 95%

Color and Shape: Solid

Molecular weight: 182.2428

Ref: IN-DA004ZRG

4-(Methylthio)benzhydrazide

CAS: 81104-42-9

4-(Methylthio)benzhydrazide

Molecular weight: 182.2428g/mol

Ref: 54-OR1021618

4-(Methylthio)benzhydrazide

CAS: 81104-42-9

Formula: C₈H₁₀N₂OS

Purity: 95%

Color and Shape: Solid

Molecular weight: 182.24

Ref: 10-F018872

4-(Methylthio)benzhydrazide

CAS: 81104-42-9

4-(Methylthio)benzhydrazide is a ligand that has been synthesized from an acid hydrazide and an ethyl ester. The synthesis of this compound involves the reaction of ethylene with methyl ester to produce the acid hydrazide, which then reacts with phenanthroline and thiocarbamate. This chemical has been used in techniques involving magnetic resonance spectroscopy and potassium hydroxide, hydrazide, coordination, chloride, carbon disulfide.

Formula: C₈H₁₀N₂OS

Purity: Min. 95%

Molecular weight: 182.24 g/mol

Ref: 3D-GDA10442