CymitQuimica logo

CAS 81110-05-6

:

methyl N-[3-(acetylsulfanyl)-2-benzylpropanoyl]glycinate

Description:
Methyl N-[3-(acetylsulfanyl)-2-benzylpropanoyl]glycinate, identified by its CAS number 81110-05-6, is a chemical compound that features a complex structure incorporating both a glycine derivative and an acetylsulfanyl group. This compound typically exhibits characteristics common to amides and esters, such as moderate solubility in polar solvents due to the presence of the glycine moiety. The acetylsulfanyl group may impart unique reactivity, potentially making it a candidate for various chemical transformations or applications in medicinal chemistry. The presence of the benzyl group suggests possible interactions with biological targets, which could be relevant in drug design. Additionally, the compound may exhibit specific spectral properties, such as characteristic absorption in infrared spectroscopy due to functional groups present in its structure. Overall, methyl N-[3-(acetylsulfanyl)-2-benzylpropanoyl]glycinate represents a compound of interest for further study in organic synthesis and pharmacological applications, although detailed experimental data would be necessary to fully characterize its properties and potential uses.
Formula:C15H19NO4S
InChI:InChI=1/C15H19NO4S/c1-11(17)21-10-13(8-12-6-4-3-5-7-12)15(19)16-9-14(18)20-2/h3-7,13H,8-10H2,1-2H3,(H,16,19)
SMILES:CC(=O)SCC(Cc1ccccc1)C(=NCC(=O)OC)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.