
CAS 81119-16-6
:2-Amino-3-chloro-3-butenoic acid
Description:
2-Amino-3-chloro-3-butenoic acid, with the CAS number 81119-16-6, is an organic compound characterized by the presence of an amino group (-NH2), a carboxylic acid group (-COOH), and a chloro substituent on a butenoic acid backbone. This compound typically appears as a white to off-white solid and is soluble in water due to its polar functional groups. It exhibits properties typical of amino acids, including the ability to participate in hydrogen bonding and form zwitterions in solution. The presence of the chlorine atom introduces unique reactivity, making it a potential intermediate in organic synthesis. Additionally, the double bond in the butenoic acid structure contributes to its reactivity, allowing for various chemical transformations. This compound may have applications in pharmaceuticals or as a building block in the synthesis of more complex molecules. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C4H6ClNO2
InChI:InChI=1S/C4H6ClNO2/c1-2(5)3(6)4(7)8/h3H,1,6H2,(H,7,8)
InChI key:InChIKey=WUOSUHNXMPQYPM-UHFFFAOYSA-N
SMILES:C(C(=C)Cl)(C(O)=O)N
Synonyms:- 3-Butenoic acid, 2-amino-3-chloro-
- 2-Amino-3-chloro-3-butenoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
