CAS 81122-95-4: (5Z)-5-hex-2-yn-1-ylidenefuran-2(5H)-one

Description:The chemical substance known as (5Z)-5-hex-2-yn-1-ylidenefuran-2(5H)-one, with the CAS number 81122-95-4, is an organic compound characterized by its unique structure, which includes a furan ring and an alkyne functional group. This compound features a conjugated system that contributes to its potential reactivity and stability. The presence of the furan moiety suggests that it may exhibit properties typical of heterocyclic compounds, such as aromaticity and the ability to participate in electrophilic or nucleophilic reactions. Additionally, the alkyne group can engage in various chemical transformations, including cycloadditions and polymerizations. The stereochemistry indicated by the "(5Z)" designation implies a specific geometric configuration around the double bond, which can influence the compound's physical and chemical properties, such as boiling point, solubility, and reactivity. Overall, this compound may have applications in organic synthesis, medicinal chemistry, or materials science, depending on its specific reactivity and interactions with other chemical species.

Formula:C₁₀H₁₀O₂

InChI:InChI=1/C10H10O2/c1-2-3-4-5-6-9-7-8-10(11)12-9/h6-8H,2-3H2,1H3/b9-6-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
(Z)-Lachnophyllum lactone REF: IN-DA005GDRCAS: 81122-95-4	- - -	To inquire	Tue 12 Aug 25
(Z)-Lachnophyllum lactone REF: TM-TN5803CAS: 81122-95-4	98%	To inquire	Wed 13 Aug 25
(Z)-Lachnophyllum lactone REF: BP-SBP02535CAS: 81122-95-4	95%~99%	To inquire	Mon 18 Aug 25
(Z)-Lachnophyllum lactone REF: 3D-GDA12295CAS: 81122-95-4	Min. 95%	- - -	Discontinued product