CAS 81123-38-8
:2-chloro-5-hydroxy-N-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl]benzenesulfonamide
Description:
2-Chloro-5-hydroxy-N-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl]benzenesulfonamide, with the CAS number 81123-38-8, is a chemical compound characterized by its complex structure, which includes a sulfonamide group, a chloro substituent, and a hydroxy group on a benzene ring. The presence of a triazine moiety indicates potential applications in agricultural chemistry, particularly as a herbicide or pesticide, due to its ability to interact with biological systems. This compound is likely to exhibit moderate to high solubility in polar solvents, given the presence of hydroxyl and sulfonamide functional groups, which can engage in hydrogen bonding. Its stability and reactivity can be influenced by the chloro and methoxy substituents, which may affect its biological activity and environmental persistence. Safety and handling precautions are essential, as with many sulfonamide derivatives, due to potential toxicity and environmental impact. Overall, this compound represents a class of chemicals with significant utility in various fields, including pharmaceuticals and agrochemicals.
Formula:C12H12ClN5O5S
InChI:InChI=1/C12H12ClN5O5S/c1-6-14-10(17-12(15-6)23-2)16-11(20)18-24(21,22)9-5-7(19)3-4-8(9)13/h3-5,19H,1-2H3,(H2,14,15,16,17,18,20)
SMILES:Cc1nc(=NC(=NS(=O)(=O)c2cc(ccc2Cl)O)O)[nH]c(n1)OC
Synonyms:- 2-Chlor-5-hydroxy-N-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl]benzolsulfonamid
- benzenesulfonamide, 2-chloro-5-hydroxy-N-[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]-
- 2-Chloro-5-hydroxy-N-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl]benzenesulfonamide
- 2-Chloro-5-hydroxy-N-[(4-méthoxy-6-méthyl-1,3,5-triazin-2-yl)carbamoyl]benzènesulfonamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5-hydroxy Chlorosulfuron
CAS:Controlled ProductFormula:C12H12ClN5O5SColor and Shape:White To Off-WhiteMolecular weight:373.77Chlorsulfuron-5-hydroxy
CAS:Chlorsulfuron-5-hydroxy is a herbicide derivative, specifically an active metabolite of chlorsulfuron, which is a sulfonylurea herbicide. This compound is derived from synthetic chemistry processes that focus on altering the molecular structure of chlorsulfuron to enhance its properties or study its breakdown. The mode of action of Chlorsulfuron-5-hydroxy involves the inhibition of the enzyme acetolactate synthase (ALS), which plays a crucial role in the biosynthesis of branched-chain amino acids in plants such as valine, leucine, and isoleucine. This inhibition disrupts protein synthesis, leading to halted cell division and plant growth.Formula:C12H12ClN5O5SPurity:Min. 95%Molecular weight:373.77 g/mol

