CymitQuimica logo

CAS 81131-74-0

:

(3R,5R)-3,5-dihydroxy-7-[(1S,2R,3S,8S,8aR)-3-hydroxy-2-methyl-8-{[(2S)-2-methylbutanoyl]oxy}-1,2,3,7,8,8a-hexahydronaphthalen-1-yl]heptanoic acid

Description:
The chemical substance known as (3R,5R)-3,5-dihydroxy-7-[(1S,2R,3S,8S,8aR)-3-hydroxy-2-methyl-8-{[(2S)-2-methylbutanoyl]oxy}-1,2,3,7,8,8a-hexahydronaphthalen-1-yl]heptanoic acid, with the CAS number 81131-74-0, is a complex organic compound characterized by its multi-functional hydroxyl groups and a long aliphatic chain. This compound features a stereochemically rich structure, indicated by multiple chiral centers, which contributes to its potential biological activity. The presence of hydroxyl groups suggests that it may exhibit hydrophilic properties, while the aliphatic and naphthalene moieties could impart lipophilicity, influencing its solubility and interaction with biological membranes. Such compounds are often studied for their pharmacological properties, including potential roles in drug development or as bioactive natural products. The intricate structure may also suggest specific binding interactions with biological targets, making it of interest in medicinal chemistry and biochemistry research.
Formula:C23H36O7
InChI:InChI=1/C23H36O7/c1-4-13(2)23(29)30-20-7-5-6-15-10-19(26)14(3)18(22(15)20)9-8-16(24)11-17(25)12-21(27)28/h5-6,10,13-14,16-20,22,24-26H,4,7-9,11-12H2,1-3H3,(H,27,28)/t13-,14+,16+,17+,18-,19+,20-,22-/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.