CymitQuimica logo

CAS 81135-57-1

:

2-Amino-4-(2E)-2-buten-1-yl-2,4,5-trideoxy-L-xylonic acid

Description:
2-Amino-4-(2E)-2-buten-1-yl-2,4,5-trideoxy-L-xylonic acid, with the CAS number 81135-57-1, is a chemical compound characterized by its unique structural features, including an amino group and a conjugated double bond. This compound is a derivative of a sugar acid, specifically a trideoxy sugar, which indicates the absence of certain hydroxyl groups typically found in sugars. Its structure suggests potential biological activity, particularly in relation to amino acid metabolism or as a precursor in biochemical pathways. The presence of the amino group may also confer properties that facilitate interactions with biological macromolecules, such as enzymes or receptors. Additionally, the compound's configuration and stereochemistry play a crucial role in its reactivity and potential applications in medicinal chemistry or biochemistry. Overall, 2-Amino-4-(2E)-2-buten-1-yl-2,4,5-trideoxy-L-xylonic acid represents a fascinating subject for further research, particularly in the context of its synthesis, reactivity, and biological significance.
Formula:C9H17NO3
InChI:InChI=1S/C9H17NO3/c1-3-4-5-6(2)8(11)7(10)9(12)13/h3-4,6-8,11H,5,10H2,1-2H3,(H,12,13)/b4-3+/t6-,7+,8-/m1/s1
InChI key:InChIKey=RPALEGQGCGCFCX-FIWMUJSFSA-N
SMILES:[C@H]([C@@H](C(O)=O)N)([C@@H](C/C=C/C)C)O
Synonyms:
  • 2-Amino-4-(2E)-2-buten-1-yl-2,4,5-trideoxy-L-xylonic acid
  • L-Xylonic acid, 2-amino-4-(2E)-2-buten-1-yl-2,4,5-trideoxy-
  • 6-Octenoic acid, 2-amino-3-hydroxy-4-methyl-, [2S-(2R*,3S*,4S*,6E)]-
  • (4R)-4-[(E)-2-Butenyl]-4-methyl-L-threonine
  • L-Xylonic acid, 2-amino-4-(2E)-2-butenyl-2,4,5-trideoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.