CAS 811431-33-1
:2-[(3aS,4R,6R,6aS)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetic acid
Description:
The chemical substance known as 2-[(3aS,4R,6R,6aS)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetic acid, with the CAS number 811431-33-1, is a complex organic compound characterized by its unique structural features. It contains a fused bicyclic system, which includes a tetrahydrofurodioxole moiety, and is substituted with an amino purine derivative, contributing to its potential biological activity. The presence of the acetic acid functional group suggests that it may exhibit acidic properties, influencing its solubility and reactivity in various environments. The stereochemistry indicated by the specific configuration at multiple chiral centers (3aS, 4R, 6R, 6aS) suggests that the compound may have specific interactions with biological targets, potentially affecting its pharmacological profile. Overall, this compound's intricate structure and functional groups may render it of interest in medicinal chemistry and drug development, particularly in the context of nucleoside analogs or related therapeutic applications.
Formula:C14H17N5O5
InChI:InChI=1/C14H17N5O5/c1-14(2)23-9-6(3-7(20)21)22-13(10(9)24-14)19-5-18-8-11(15)16-4-17-12(8)19/h4-6,9-10,13H,3H2,1-2H3,(H,20,21)(H2,15,16,17)/t6-,9+,10+,13-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5''-Carboxy-2'',3''-O-isopropylideneadenosine
CAS:Formula:C13H15N5O5Purity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:321.305'-Carboxy-2',3'-O-isopropylideneadenosine
CAS:5'-Carboxy-2',3'-O-isopropylideneadenosine is a novel deoxyribonucleoside. It has high purity and high quality, good stability, and a low price. This product can be used as the raw material for synthesis of DNA, RNA, and phosphoramidites. It is an anticancer drug and antiviral agent that can be used to synthesize new drugs. It also has strong anti-inflammatory properties.Formula:C13H15N5O5Purity:Min. 95%Color and Shape:PowderMolecular weight:321.3 g/mol

