CymitQuimica logo

CAS 811439-31-3

:

2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine hydrochloride

Description:
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine hydrochloride is a chemical compound characterized by its unique structure, which includes a piperidine ring and a boron-containing dioxaborolane moiety. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, including cross-coupling reactions. The presence of the dioxaborolane group enhances its reactivity and solubility in organic solvents. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. The compound is likely to exhibit properties typical of piperidine derivatives, such as potential biological activity, including analgesic or anti-inflammatory effects. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure safe laboratory practices. Overall, this compound represents a valuable tool in synthetic chemistry, particularly in the context of boron chemistry.
Formula:C11H23BClNO2
InChI:InChI=1/C11H22BNO2.ClH/c1-10(2)11(3,4)15-12(14-10)9-7-5-6-8-13-9;/h9,13H,5-8H2,1-4H3;1H
SMILES:CC1(C)C(C)(C)OB(C2CCCCN2)O1.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.