CAS 811460-27-2
:4,4′-(9,9-Dioctyl-9H-fluorene-2,7-diyl)bis[pyridine]
Description:
4,4′-(9,9-Dioctyl-9H-fluorene-2,7-diyl)bis[pyridine] is an organic compound characterized by its unique structure, which features a fluorene core substituted with two pyridine groups. The presence of the dioctyl groups enhances its solubility in organic solvents, making it suitable for various applications in organic electronics and materials science. This compound exhibits interesting optical properties, including fluorescence, due to the conjugated system formed by the fluorene and pyridine moieties. The pyridine rings can participate in coordination chemistry, potentially allowing for interactions with metal ions or other substrates. Additionally, the compound's structure may impart specific electronic properties, making it a candidate for use in organic light-emitting diodes (OLEDs), organic photovoltaics, or as a building block in supramolecular chemistry. Its stability and reactivity can be influenced by the substituents on the fluorene and pyridine rings, which can be tailored for specific applications. Overall, this compound represents a versatile platform for research in advanced materials and organic synthesis.
Formula:C39H48N2
InChI:InChI=1S/C39H48N2/c1-3-5-7-9-11-13-23-39(24-14-12-10-8-6-4-2)37-29-33(31-19-25-40-26-20-31)15-17-35(37)36-18-16-34(30-38(36)39)32-21-27-41-28-22-32/h15-22,25-30H,3-14,23-24H2,1-2H3
InChI key:InChIKey=UFBXEKXUBNQTRL-UHFFFAOYSA-N
SMILES:C(CCCCCCC)C1(CCCCCCCC)C=2C(C=3C1=CC(=CC3)C=4C=CN=CC4)=CC=C(C2)C=5C=CN=CC5
Synonyms:- 4,4′-(9,9-Dioctyl-9H-fluorene-2,7-diyl)bis[pyridine]
- Pyridine, 4,4′-(9,9-dioctyl-9H-fluorene-2,7-diyl)bis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
